C22H29N3O4 — CID 164615241
tert-butyl N-[(3R)-1-[(2-hydroxy-4-methoxyphenyl)-pyridin-4-ylmethyl]pyrrolidin-3-yl]carbamate (PubChem CID 164615241) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[(2-hydroxy-4-methoxyphenyl)-pyridin-4-ylmethyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[(2-hydroxy-4-methoxyphenyl)-pyridin-4-ylmethyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 164615241 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | tert-butyl N-[(3R)-1-[(2-hydroxy-4-methoxyphenyl)-pyridin-4-ylmethyl]pyrrolidin-3-yl]carbamate |
| SMILES | COc1ccc(C(c2ccncc2)N2CC[C@@H](NC(=O)OC(C)(C)C)C2)c(O)c1 |
| InChI | InChI=1S/C22H29N3O4/c1-22(2,3)29-21(27)24-16-9-12-25(14-16)20(15-7-10-23-11-8-15)18-6-5-17(28-4)13-19(18)26/h5-8,10-11,13,16,20,26H,9,12,14H2,1-4H3,(H,24,27)/t16-,20?/m1/s1 |
| InChIKey | AHXDYZAMIRYNGR-QRIPLOBPSA-N |
| XLogP | 3.48 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|