C9H12O5 — CID 156779963
[3,4-bis(hydroxymethoxy)phenyl]methanol (PubChem CID 156779963) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is [3,4-bis(hydroxymethoxy)phenyl]methanol.
| Compound Name | [3,4-bis(hydroxymethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 156779963 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | [3,4-bis(hydroxymethoxy)phenyl]methanol |
| SMILES | OCOc1ccc(CO)cc1OCO |
| InChI | InChI=1S/C9H12O5/c10-4-7-1-2-8(13-5-11)9(3-7)14-6-12/h1-3,10-12H,4-6H2 |
| InChIKey | JALAUMLSOBIGGL-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|