C14H24N2O4 — CID 156780278
N,N,N',N'-tetrakis(prop-2-enoxy)ethane-1,2-diamine (PubChem CID 156780278) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(prop-2-enoxy)ethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrakis(prop-2-enoxy)ethane-1,2-diamine |
|---|---|
| PubChem CID | 156780278 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N,N,N',N'-tetrakis(prop-2-enoxy)ethane-1,2-diamine |
| SMILES | C=CCON(CCN(OCC=C)OCC=C)OCC=C |
| InChI | InChI=1S/C14H24N2O4/c1-5-11-17-15(18-12-6-2)9-10-16(19-13-7-3)20-14-8-4/h5-8H,1-4,9-14H2 |
| InChIKey | WBVULZVQBKVJDJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|