C12H14N2O4-2 — CID 163956450
1-N,3-N-dioxido-1-N,3-N-bis(prop-2-enoxy)benzene-1,3-diamine (PubChem CID 163956450) has the molecular formula C12H14N2O4-2 and a molecular weight of 250.25 g/mol. Its IUPAC name is 1-N,3-N-dioxido-1-N,3-N-bis(prop-2-enoxy)benzene-1,3-diamine.
| Compound Name | 1-N,3-N-dioxido-1-N,3-N-bis(prop-2-enoxy)benzene-1,3-diamine |
|---|---|
| PubChem CID | 163956450 |
| Molecular Formula | C12H14N2O4-2 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-N,3-N-dioxido-1-N,3-N-bis(prop-2-enoxy)benzene-1,3-diamine |
| SMILES | C=CCON([O-])c1cccc(N([O-])OCC=C)c1 |
| InChI | InChI=1S/C12H14N2O4/c1-3-8-17-13(15)11-6-5-7-12(10-11)14(16)18-9-4-2/h3-7,10H,1-2,8-9H2/q-2 |
| InChIKey | XYXVDDXRYJPHSI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|