C18H15N3 — CID 156780758
1-methyl-9-(pyridin-3-ylmethyl)pyrido[3,4-b]indole (PubChem CID 156780758) has the molecular formula C18H15N3 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-methyl-9-(pyridin-3-ylmethyl)pyrido[3,4-b]indole.
| Compound Name | 1-methyl-9-(pyridin-3-ylmethyl)pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 156780758 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-methyl-9-(pyridin-3-ylmethyl)pyrido[3,4-b]indole |
| SMILES | Cc1nccc2c3ccccc3n(Cc3cccnc3)c12 |
| InChI | InChI=1S/C18H15N3/c1-13-18-16(8-10-20-13)15-6-2-3-7-17(15)21(18)12-14-5-4-9-19-11-14/h2-11H,12H2,1H3 |
| InChIKey | VKSARRBQJCBNKO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |