C18H24O3 — CID 156781895
tert-butyl 1-(5-methyl-2-prop-1-en-2-ylphenoxy)cyclopropane-1-carboxylate (PubChem CID 156781895) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is tert-butyl 1-(5-methyl-2-prop-1-en-2-ylphenoxy)cyclopropane-1-carboxylate.
| Compound Name | tert-butyl 1-(5-methyl-2-prop-1-en-2-ylphenoxy)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 156781895 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | tert-butyl 1-(5-methyl-2-prop-1-en-2-ylphenoxy)cyclopropane-1-carboxylate |
| SMILES | C=C(C)c1ccc(C)cc1OC1(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H24O3/c1-12(2)14-8-7-13(3)11-15(14)20-18(9-10-18)16(19)21-17(4,5)6/h7-8,11H,1,9-10H2,2-6H3 |
| InChIKey | MFLMWCVDPDCGJS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |