C25H27F2NO5 — CID 156783458
methyl 1-[[(E)-3-[4-[(3,5-difluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]cyclohexane-1-carboxylate (PubChem CID 156783458) has the molecular formula C25H27F2NO5 and a molecular weight of 459.49 g/mol. Its IUPAC name is methyl 1-[[(E)-3-[4-[(3,5-difluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[(E)-3-[4-[(3,5-difluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 156783458 |
| Molecular Formula | C25H27F2NO5 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | methyl 1-[[(E)-3-[4-[(3,5-difluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)/C=C/c2ccc(OCc3cc(F)cc(F)c3)c(OC)c2)CCCCC1 |
| InChI | InChI=1S/C25H27F2NO5/c1-31-22-14-17(6-8-21(22)33-16-18-12-19(26)15-20(27)13-18)7-9-23(29)28-25(24(30)32-2)10-4-3-5-11-25/h6-9,12-15H,3-5,10-11,16H2,1-2H3,(H,28,29)/b9-7+ |
| InChIKey | PQGLJOMDPKSKAK-VQHVLOKHSA-N |
| XLogP | 4.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|