C24H25F2NO5 — CID 175166048
[[(E)-3-[4-[(3,5-difluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino] cyclohexanecarboxylate (PubChem CID 175166048) has the molecular formula C24H25F2NO5 and a molecular weight of 445.46 g/mol. Its IUPAC name is [[(E)-3-[4-[(3,5-difluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino] cyclohexanecarboxylate.
| Compound Name | [[(E)-3-[4-[(3,5-difluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 175166048 |
| Molecular Formula | C24H25F2NO5 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [[(E)-3-[4-[(3,5-difluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino] cyclohexanecarboxylate |
| SMILES | COc1cc(/C=C/C(=O)NOC(=O)C2CCCCC2)ccc1OCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H25F2NO5/c1-30-22-13-16(7-9-21(22)31-15-17-11-19(25)14-20(26)12-17)8-10-23(28)27-32-24(29)18-5-3-2-4-6-18/h7-14,18H,2-6,15H2,1H3,(H,27,28)/b10-8+ |
| InChIKey | OMOGSZWJAVMZED-CSKARUKUSA-N |
| XLogP | 4.72 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|