C17H16N2O4 — CID 156784115
diethyl 3-(2-pyridin-3-ylethynyl)-1H-pyrrole-2,4-dicarboxylate (PubChem CID 156784115) has the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. Its IUPAC name is diethyl 3-(2-pyridin-3-ylethynyl)-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 3-(2-pyridin-3-ylethynyl)-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 156784115 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | diethyl 3-(2-pyridin-3-ylethynyl)-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c[nH]c(C(=O)OCC)c1C#Cc1cccnc1 |
| InChI | InChI=1S/C17H16N2O4/c1-3-22-16(20)14-11-19-15(17(21)23-4-2)13(14)8-7-12-6-5-9-18-10-12/h5-6,9-11,19H,3-4H2,1-2H3 |
| InChIKey | AKRUAQSQTUSGRP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|