C13H10N2O3 — CID 162391910
ethyl 2-(2-pyridin-3-ylethynyl)-1,3-oxazole-5-carboxylate (PubChem CID 162391910) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is ethyl 2-(2-pyridin-3-ylethynyl)-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 2-(2-pyridin-3-ylethynyl)-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 162391910 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | ethyl 2-(2-pyridin-3-ylethynyl)-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C#Cc2cccnc2)o1 |
| InChI | InChI=1S/C13H10N2O3/c1-2-17-13(16)11-9-15-12(18-11)6-5-10-4-3-7-14-8-10/h3-4,7-9H,2H2,1H3 |
| InChIKey | IURVQLACHBOZJH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|