C17H15N3O3 — CID 156785092
methyl 2-[(2-amino-4-phenyl-1,3-oxazol-5-yl)amino]benzoate (PubChem CID 156785092) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is methyl 2-[(2-amino-4-phenyl-1,3-oxazol-5-yl)amino]benzoate.
| Compound Name | methyl 2-[(2-amino-4-phenyl-1,3-oxazol-5-yl)amino]benzoate |
|---|---|
| PubChem CID | 156785092 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | methyl 2-[(2-amino-4-phenyl-1,3-oxazol-5-yl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1oc(N)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H15N3O3/c1-22-16(21)12-9-5-6-10-13(12)19-15-14(20-17(18)23-15)11-7-3-2-4-8-11/h2-10,19H,1H3,(H2,18,20) |
| InChIKey | RPJFLOWANGVJET-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |