C24H28N2O3 — CID 156785339
7-[(E)-4-[[(1R,2R)-2-(2-methoxyphenyl)cyclopropyl]methylamino]but-2-enoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 156785339) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 7-[(E)-4-[[(1R,2R)-2-(2-methoxyphenyl)cyclopropyl]methylamino]but-2-enoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[(E)-4-[[(1R,2R)-2-(2-methoxyphenyl)cyclopropyl]methylamino]but-2-enoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 156785339 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 7-[(E)-4-[[(1R,2R)-2-(2-methoxyphenyl)cyclopropyl]methylamino]but-2-enoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1ccccc1[C@@H]1C[C@H]1CNC/C=C/COc1ccc2c(c1)NC(=O)CC2 |
| InChI | InChI=1S/C24H28N2O3/c1-28-23-7-3-2-6-20(23)21-14-18(21)16-25-12-4-5-13-29-19-10-8-17-9-11-24(27)26-22(17)15-19/h2-8,10,15,18,21,25H,9,11-14,16H2,1H3,(H,26,27)/b5-4+/t18-,21+/m0/s1 |
| InChIKey | SRFNDHKXJPAPGT-BLCVROGKSA-N |
| XLogP | 3.91 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|