C22H28N2O2S — CID 175164276
7-[4-[[2-(2-methylthiophen-3-yl)cyclopropyl]methylamino]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 175164276) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is 7-[4-[[2-(2-methylthiophen-3-yl)cyclopropyl]methylamino]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-[[2-(2-methylthiophen-3-yl)cyclopropyl]methylamino]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 175164276 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 7-[4-[[2-(2-methylthiophen-3-yl)cyclopropyl]methylamino]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1sccc1C1CC1CNCCCCOc1ccc2c(c1)NC(=O)CC2 |
| InChI | InChI=1S/C22H28N2O2S/c1-15-19(8-11-27-15)20-12-17(20)14-23-9-2-3-10-26-18-6-4-16-5-7-22(25)24-21(16)13-18/h4,6,8,11,13,17,20,23H,2-3,5,7,9-10,12,14H2,1H3,(H,24,25) |
| InChIKey | RBZGESJLJOZHJQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|