C10H12F3NO3 — CID 156785945
(7-oxo-2-azaspiro[3.5]nonan-3-yl) 2,2,2-trifluoroacetate (PubChem CID 156785945) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is (7-oxo-2-azaspiro[3.5]nonan-3-yl) 2,2,2-trifluoroacetate.
| Compound Name | (7-oxo-2-azaspiro[3.5]nonan-3-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156785945 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (7-oxo-2-azaspiro[3.5]nonan-3-yl) 2,2,2-trifluoroacetate |
| SMILES | O=C1CCC2(CC1)CNC2OC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO3/c11-10(12,13)8(16)17-7-9(5-14-7)3-1-6(15)2-4-9/h7,14H,1-5H2 |
| InChIKey | AUVLCIAXIFAKHE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |