C18H20O3 — CID 156787489
2,2-dimethoxy-1,4-diphenylbutan-1-one (PubChem CID 156787489) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2,2-dimethoxy-1,4-diphenylbutan-1-one.
| Compound Name | 2,2-dimethoxy-1,4-diphenylbutan-1-one |
|---|---|
| PubChem CID | 156787489 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2,2-dimethoxy-1,4-diphenylbutan-1-one |
| SMILES | COC(CCc1ccccc1)(OC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-20-18(21-2,14-13-15-9-5-3-6-10-15)17(19)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | FIYNTLHINDVBBT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|