C34H40N8O2S2 — CID 15678853
1-(3-isothiocyanatophenyl)-3-[8-[4-[2-oxo-2-(6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepin-11-yl)ethyl]piperazin-1-yl]octyl]thiourea (PubChem CID 15678853) has the molecular formula C34H40N8O2S2 and a molecular weight of 656.88 g/mol. Its IUPAC name is 1-(3-isothiocyanatophenyl)-3-[8-[4-[2-oxo-2-(6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepin-11-yl)ethyl]piperazin-1-yl]octyl]thiourea.
| Compound Name | 1-(3-isothiocyanatophenyl)-3-[8-[4-[2-oxo-2-(6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepin-11-yl)ethyl]piperazin-1-yl]octyl]thiourea |
|---|---|
| PubChem CID | 15678853 |
| Molecular Formula | C34H40N8O2S2 |
| Molecular Weight | 656.88 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 1-(3-isothiocyanatophenyl)-3-[8-[4-[2-oxo-2-(6-oxo-5H-pyrido[2,3-b][1,4]benzodiazepin-11-yl)ethyl]piperazin-1-yl]octyl]thiourea |
| SMILES | O=C1Nc2cccnc2N(C(=O)CN2CCN(CCCCCCCCNC(=S)Nc3cccc(N=C=S)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C34H40N8O2S2/c43-31(42-30-15-6-5-13-28(30)33(44)39-29-14-10-17-35-32(29)42)24-41-21-19-40(20-22-41)18-8-4-2-1-3-7-16-36-34(46)38-27-12-9-11-26(23-27)37-25-45/h5-6,9-15,17,23H,1-4,7-8,16,18-22,24H2,(H,39,44)(H2,36,38,46) |
| InChIKey | AMKANZICHZVXTJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.88 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|