C36H38N6O2 — CID 156789446
2-[3-[1-[[2-methyl-6-(1-prop-2-enylindol-6-yl)pyrimidin-4-yl]amino]ethyl]phenoxy]-1-(4-pyridin-2-ylpiperidin-1-yl)ethanone (PubChem CID 156789446) has the molecular formula C36H38N6O2 and a molecular weight of 586.74 g/mol. Its IUPAC name is 2-[3-[1-[[2-methyl-6-(1-prop-2-enylindol-6-yl)pyrimidin-4-yl]amino]ethyl]phenoxy]-1-(4-pyridin-2-ylpiperidin-1-yl)ethanone.
| Compound Name | 2-[3-[1-[[2-methyl-6-(1-prop-2-enylindol-6-yl)pyrimidin-4-yl]amino]ethyl]phenoxy]-1-(4-pyridin-2-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 156789446 |
| Molecular Formula | C36H38N6O2 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | 2-[3-[1-[[2-methyl-6-(1-prop-2-enylindol-6-yl)pyrimidin-4-yl]amino]ethyl]phenoxy]-1-(4-pyridin-2-ylpiperidin-1-yl)ethanone |
| SMILES | C=CCn1ccc2ccc(-c3cc(NC(C)c4cccc(OCC(=O)N5CCC(c6ccccn6)CC5)c4)nc(C)n3)cc21 |
| InChI | InChI=1S/C36H38N6O2/c1-4-17-41-18-15-28-11-12-30(22-34(28)41)33-23-35(40-26(3)39-33)38-25(2)29-8-7-9-31(21-29)44-24-36(43)42-19-13-27(14-20-42)32-10-5-6-16-37-32/h4-12,15-16,18,21-23,25,27H,1,13-14,17,19-20,24H2,2-3H3,(H,38,39,40) |
| InChIKey | KWOVECDXEXBHBN-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|