C25H25ClF2N4O2 — CID 156789606
N-[4-[chloro(difluoro)methoxy]phenyl]-1-cyclohexyl-7-(1H-pyrazol-5-yl)-2,3-dihydroindole-5-carboxamide (PubChem CID 156789606) has the molecular formula C25H25ClF2N4O2 and a molecular weight of 486.95 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-1-cyclohexyl-7-(1H-pyrazol-5-yl)-2,3-dihydroindole-5-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-1-cyclohexyl-7-(1H-pyrazol-5-yl)-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 156789606 |
| Molecular Formula | C25H25ClF2N4O2 |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-1-cyclohexyl-7-(1H-pyrazol-5-yl)-2,3-dihydroindole-5-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1cc2c(c(-c3ccn[nH]3)c1)N(C1CCCCC1)CC2 |
| InChI | InChI=1S/C25H25ClF2N4O2/c26-25(27,28)34-20-8-6-18(7-9-20)30-24(33)17-14-16-11-13-32(19-4-2-1-3-5-19)23(16)21(15-17)22-10-12-29-31-22/h6-10,12,14-15,19H,1-5,11,13H2,(H,29,31)(H,30,33) |
| InChIKey | XACDPJUAFCAGSU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|