C23H22ClF2N5O5 — CID 146458618
N-[4-[chloro(difluoro)methoxy]phenyl]-4-(3-hydroxy-3-methylpiperidin-1-yl)-3-nitro-5-(1H-pyrazol-5-yl)benzamide (PubChem CID 146458618) has the molecular formula C23H22ClF2N5O5 and a molecular weight of 521.91 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-4-(3-hydroxy-3-methylpiperidin-1-yl)-3-nitro-5-(1H-pyrazol-5-yl)benzamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-4-(3-hydroxy-3-methylpiperidin-1-yl)-3-nitro-5-(1H-pyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 146458618 |
| Molecular Formula | C23H22ClF2N5O5 |
| Molecular Weight | 521.91 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-4-(3-hydroxy-3-methylpiperidin-1-yl)-3-nitro-5-(1H-pyrazol-5-yl)benzamide |
| SMILES | CC1(O)CCCN(c2c(-c3ccn[nH]3)cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C23H22ClF2N5O5/c1-22(33)8-2-10-30(13-22)20-17(18-7-9-27-29-18)11-14(12-19(20)31(34)35)21(32)28-15-3-5-16(6-4-15)36-23(24,25)26/h3-7,9,11-12,33H,2,8,10,13H2,1H3,(H,27,29)(H,28,32) |
| InChIKey | NVWQISOEDKPMLI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.91 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|