C29H33ClF2N4O4Si — CID 156789585
3'-[tert-butyl(dimethyl)silyl]oxy-N-[4-[chloro(difluoro)methoxy]phenyl]-2-oxo-4-(1H-pyrazol-5-yl)spiro[1H-indole-3,1'-cyclopentane]-6-carboxamide (PubChem CID 156789585) has the molecular formula C29H33ClF2N4O4Si and a molecular weight of 603.14 g/mol. Its IUPAC name is 3'-[tert-butyl(dimethyl)silyl]oxy-N-[4-[chloro(difluoro)methoxy]phenyl]-2-oxo-4-(1H-pyrazol-5-yl)spiro[1H-indole-3,1'-cyclopentane]-6-carboxamide.
| Compound Name | 3'-[tert-butyl(dimethyl)silyl]oxy-N-[4-[chloro(difluoro)methoxy]phenyl]-2-oxo-4-(1H-pyrazol-5-yl)spiro[1H-indole-3,1'-cyclopentane]-6-carboxamide |
|---|---|
| PubChem CID | 156789585 |
| Molecular Formula | C29H33ClF2N4O4Si |
| Molecular Weight | 603.14 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | 3'-[tert-butyl(dimethyl)silyl]oxy-N-[4-[chloro(difluoro)methoxy]phenyl]-2-oxo-4-(1H-pyrazol-5-yl)spiro[1H-indole-3,1'-cyclopentane]-6-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC2(C1)C(=O)Nc1cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc(-c3ccn[nH]3)c12 |
| InChI | InChI=1S/C29H33ClF2N4O4Si/c1-27(2,3)41(4,5)40-20-10-12-28(16-20)24-21(22-11-13-33-36-22)14-17(15-23(24)35-26(28)38)25(37)34-18-6-8-19(9-7-18)39-29(30,31)32/h6-9,11,13-15,20H,10,12,16H2,1-5H3,(H,33,36)(H,34,37)(H,35,38) |
| InChIKey | IJUANCZETSBVEL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.14 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|