C26H33BrN2O4Si — CID 167616389
4-bromo-3'-[tert-butyl(dimethyl)silyl]oxy-N-(4-methoxyphenyl)-2-oxospiro[1H-indole-3,1'-cyclopentane]-6-carboxamide (PubChem CID 167616389) has the molecular formula C26H33BrN2O4Si and a molecular weight of 545.55 g/mol. Its IUPAC name is 4-bromo-3'-[tert-butyl(dimethyl)silyl]oxy-N-(4-methoxyphenyl)-2-oxospiro[1H-indole-3,1'-cyclopentane]-6-carboxamide.
| Compound Name | 4-bromo-3'-[tert-butyl(dimethyl)silyl]oxy-N-(4-methoxyphenyl)-2-oxospiro[1H-indole-3,1'-cyclopentane]-6-carboxamide |
|---|---|
| PubChem CID | 167616389 |
| Molecular Formula | C26H33BrN2O4Si |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 4-bromo-3'-[tert-butyl(dimethyl)silyl]oxy-N-(4-methoxyphenyl)-2-oxospiro[1H-indole-3,1'-cyclopentane]-6-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(Br)c3c(c2)NC(=O)C32CCC(O[Si](C)(C)C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C26H33BrN2O4Si/c1-25(2,3)34(5,6)33-19-11-12-26(15-19)22-20(27)13-16(14-21(22)29-24(26)31)23(30)28-17-7-9-18(32-4)10-8-17/h7-10,13-14,19H,11-12,15H2,1-6H3,(H,28,30)(H,29,31) |
| InChIKey | LUNKMTFVRITYAS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|