C7H4BrNO2S — CID 156790121
4-bromo-6-sulfonylcyclohexa-2,4-diene-1-carbonitrile (PubChem CID 156790121) has the molecular formula C7H4BrNO2S and a molecular weight of 246.09 g/mol. Its IUPAC name is 4-bromo-6-sulfonylcyclohexa-2,4-diene-1-carbonitrile.
| Compound Name | 4-bromo-6-sulfonylcyclohexa-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 156790121 |
| Molecular Formula | C7H4BrNO2S |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 244.91 |
| IUPAC Name | 4-bromo-6-sulfonylcyclohexa-2,4-diene-1-carbonitrile |
| SMILES | N#CC1C=CC(Br)=CC1=S(=O)=O |
| InChI | InChI=1S/C7H4BrNO2S/c8-6-2-1-5(4-9)7(3-6)12(10)11/h1-3,5H |
| InChIKey | OWZKNCFJAWVXDY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|