C6H4N2S2 — CID 154732142
2,6-bis(sulfanylidene)-3H-pyridine-3-carbonitrile (PubChem CID 154732142) has the molecular formula C6H4N2S2 and a molecular weight of 168.25 g/mol. Its IUPAC name is 2,6-bis(sulfanylidene)-3H-pyridine-3-carbonitrile.
| Compound Name | 2,6-bis(sulfanylidene)-3H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154732142 |
| Molecular Formula | C6H4N2S2 |
| Molecular Weight | 168.25 g/mol |
| Exact Mass | 167.98 |
| IUPAC Name | 2,6-bis(sulfanylidene)-3H-pyridine-3-carbonitrile |
| SMILES | N#CC1C=CC(=S)NC1=S |
| InChI | InChI=1S/C6H4N2S2/c7-3-4-1-2-5(9)8-6(4)10/h1-2,4H,(H,8,9,10) |
| InChIKey | VGYFIDKKGPZLKZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|