C13H9F2NO — CID 156790201
N-(2,2-difluoroethenyl)naphthalene-2-carboxamide (PubChem CID 156790201) has the molecular formula C13H9F2NO and a molecular weight of 233.22 g/mol. Its IUPAC name is N-(2,2-difluoroethenyl)naphthalene-2-carboxamide.
| Compound Name | N-(2,2-difluoroethenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 156790201 |
| Molecular Formula | C13H9F2NO |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-(2,2-difluoroethenyl)naphthalene-2-carboxamide |
| SMILES | O=C(NC=C(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H9F2NO/c14-12(15)8-16-13(17)11-6-5-9-3-1-2-4-10(9)7-11/h1-8H,(H,16,17) |
| InChIKey | MLASYWCNMKMZEM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |