C22H42N4O4S — CID 156791282
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-methyl-4-[4-(methylamino)butan-2-yloxy]butan-2-yl]oxyethyl]pentanamide (PubChem CID 156791282) has the molecular formula C22H42N4O4S and a molecular weight of 458.67 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-methyl-4-[4-(methylamino)butan-2-yloxy]butan-2-yl]oxyethyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-methyl-4-[4-(methylamino)butan-2-yloxy]butan-2-yl]oxyethyl]pentanamide |
|---|---|
| PubChem CID | 156791282 |
| Molecular Formula | C22H42N4O4S |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-methyl-4-[4-(methylamino)butan-2-yloxy]butan-2-yl]oxyethyl]pentanamide |
| SMILES | CNCCC(C)OCCC(C)(C)OCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C22H42N4O4S/c1-16(9-11-23-4)29-13-10-22(2,3)30-14-12-24-19(27)8-6-5-7-18-20-17(15-31-18)25-21(28)26-20/h16-18,20,23H,5-15H2,1-4H3,(H,24,27)(H2,25,26,28)/t16?,17-,18-,20-/m0/s1 |
| InChIKey | MNRIXSAWTVVCDS-XXPVTVGNSA-N |
| XLogP | 2.03 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|