C21H34ClNO3 — CID 156792010
ethane;ethyl 2-(chloromethyl)-4-[1-(1-ethylpiperidin-2-yl)ethoxy]benzoate (PubChem CID 156792010) has the molecular formula C21H34ClNO3 and a molecular weight of 383.96 g/mol. Its IUPAC name is ethane;ethyl 2-(chloromethyl)-4-[1-(1-ethylpiperidin-2-yl)ethoxy]benzoate.
| Compound Name | ethane;ethyl 2-(chloromethyl)-4-[1-(1-ethylpiperidin-2-yl)ethoxy]benzoate |
|---|---|
| PubChem CID | 156792010 |
| Molecular Formula | C21H34ClNO3 |
| Molecular Weight | 383.96 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | ethane;ethyl 2-(chloromethyl)-4-[1-(1-ethylpiperidin-2-yl)ethoxy]benzoate |
| SMILES | CC.CCOC(=O)c1ccc(OC(C)C2CCCCN2CC)cc1CCl |
| InChI | InChI=1S/C19H28ClNO3.C2H6/c1-4-21-11-7-6-8-18(21)14(3)24-16-9-10-17(15(12-16)13-20)19(22)23-5-2;1-2/h9-10,12,14,18H,4-8,11,13H2,1-3H3;1-2H3 |
| InChIKey | TYFWIZZDIOKQAO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.96 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|