C19H26ClNO3 — CID 166154206
ethyl 2-(chloromethyl)-4-[[(8R)-6-ethyl-6-azaspiro[2.5]octan-8-yl]oxy]benzoate (PubChem CID 166154206) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-4-[[(8R)-6-ethyl-6-azaspiro[2.5]octan-8-yl]oxy]benzoate.
| Compound Name | ethyl 2-(chloromethyl)-4-[[(8R)-6-ethyl-6-azaspiro[2.5]octan-8-yl]oxy]benzoate |
|---|---|
| PubChem CID | 166154206 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | ethyl 2-(chloromethyl)-4-[[(8R)-6-ethyl-6-azaspiro[2.5]octan-8-yl]oxy]benzoate |
| SMILES | CCOC(=O)c1ccc(O[C@H]2CN(CC)CCC23CC3)cc1CCl |
| InChI | InChI=1S/C19H26ClNO3/c1-3-21-10-9-19(7-8-19)17(13-21)24-15-5-6-16(14(11-15)12-20)18(22)23-4-2/h5-6,11,17H,3-4,7-10,12-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | CAUDHCXPMKVSAS-KRWDZBQOSA-N |
| XLogP | 3.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|