C25H23ClN6O — CID 156792269
1-[6-[4-(5-chloro-1H-indazol-4-yl)-5-methyl-3-pyridin-3-ylpyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one (PubChem CID 156792269) has the molecular formula C25H23ClN6O and a molecular weight of 458.95 g/mol. Its IUPAC name is 1-[6-[4-(5-chloro-1H-indazol-4-yl)-5-methyl-3-pyridin-3-ylpyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[4-(5-chloro-1H-indazol-4-yl)-5-methyl-3-pyridin-3-ylpyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156792269 |
| Molecular Formula | C25H23ClN6O |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-[6-[4-(5-chloro-1H-indazol-4-yl)-5-methyl-3-pyridin-3-ylpyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CC(n3nc(-c4cccnc4)c(-c4c(Cl)ccc5[nH]ncc45)c3C)C2)C1 |
| InChI | InChI=1S/C25H23ClN6O/c1-3-21(33)31-13-25(14-31)9-17(10-25)32-15(2)22(24(30-32)16-5-4-8-27-11-16)23-18-12-28-29-20(18)7-6-19(23)26/h3-8,11-12,17H,1,9-10,13-14H2,2H3,(H,28,29) |
| InChIKey | GPSWEICMVSMBQY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|