C25H25ClN6O — CID 156512527
1-[4-[4-(5-chloro-1H-indazol-4-yl)-5-methyl-3-(2-methyl-4-pyridinyl)pyrazol-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 156512527) has the molecular formula C25H25ClN6O and a molecular weight of 460.97 g/mol. Its IUPAC name is 1-[4-[4-(5-chloro-1H-indazol-4-yl)-5-methyl-3-(2-methyl-4-pyridinyl)pyrazol-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-(5-chloro-1H-indazol-4-yl)-5-methyl-3-(2-methyl-4-pyridinyl)pyrazol-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156512527 |
| Molecular Formula | C25H25ClN6O |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-[4-[4-(5-chloro-1H-indazol-4-yl)-5-methyl-3-(2-methyl-4-pyridinyl)pyrazol-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(n2nc(-c3ccnc(C)c3)c(-c3c(Cl)ccc4[nH]ncc34)c2C)CC1 |
| InChI | InChI=1S/C25H25ClN6O/c1-4-22(33)31-11-8-18(9-12-31)32-16(3)23(25(30-32)17-7-10-27-15(2)13-17)24-19-14-28-29-21(19)6-5-20(24)26/h4-7,10,13-14,18H,1,8-9,11-12H2,2-3H3,(H,28,29) |
| InChIKey | MLOFGWPWELQUDN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|