C35H39ClN8OSi — CID 156792383
CID 156792383 (PubChem CID 156792383) has the molecular formula C35H39ClN8OSi and a molecular weight of 651.29 g/mol.
| Compound Name | CID 156792383 |
|---|---|
| PubChem CID | 156792383 |
| Molecular Formula | C35H39ClN8OSi |
| Molecular Weight | 651.29 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CCC(n2nc(-c3ccc4c(cnn4CCN4CC[C@H](C=C)[Si]C4)c3)c(-c3c(Cl)c(C)cc4[nH]ncc34)c2C)CC1 |
| InChI | InChI=1S/C35H39ClN8OSi/c1-5-27-11-12-41(21-46-27)15-16-43-30-8-7-24(18-25(30)19-38-43)35-32(33-28-20-37-39-29(28)17-22(3)34(33)36)23(4)44(40-35)26-9-13-42(14-10-26)31(45)6-2/h5-8,17-20,26-27H,1-2,9-16,21H2,3-4H3,(H,37,39)/t27-/m0/s1 |
| InChIKey | GRDNTGFXNWHXOX-MHZLTWQESA-N |
| XLogP | 6.40 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.29 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|