C32H38ClN7O — CID 156792248
5-chloro-6-methyl-4-[5-methyl-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)-3-(1-methylindazol-5-yl)pyrazol-4-yl]-1H-indazole;ethane;prop-2-enal (PubChem CID 156792248) has the molecular formula C32H38ClN7O and a molecular weight of 572.16 g/mol. Its IUPAC name is 5-chloro-6-methyl-4-[5-methyl-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)-3-(1-methylindazol-5-yl)pyrazol-4-yl]-1H-indazole;ethane;prop-2-enal.
| Compound Name | 5-chloro-6-methyl-4-[5-methyl-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)-3-(1-methylindazol-5-yl)pyrazol-4-yl]-1H-indazole;ethane;prop-2-enal |
|---|---|
| PubChem CID | 156792248 |
| Molecular Formula | C32H38ClN7O |
| Molecular Weight | 572.16 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 5-chloro-6-methyl-4-[5-methyl-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)-3-(1-methylindazol-5-yl)pyrazol-4-yl]-1H-indazole;ethane;prop-2-enal |
| SMILES | C=CC=O.CC.Cc1cc2[nH]ncc2c(-c2c(-c3ccc4c(cnn4C)c3)nn(C3CC4(C3)CN(C)C4)c2C)c1Cl |
| InChI | InChI=1S/C27H28ClN7.C3H4O.C2H6/c1-15-7-21-20(12-29-31-21)24(25(15)28)23-16(2)35(19-9-27(10-19)13-33(3)14-27)32-26(23)17-5-6-22-18(8-17)11-30-34(22)4;1-2-3-4;1-2/h5-8,11-12,19H,9-10,13-14H2,1-4H3,(H,29,31);2-3H,1H2;1-2H3 |
| InChIKey | AWKGODRVANSTTL-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.16 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|