C27H29IN7P — CID 156792242
iodo-[6-methyl-4-[5-methyl-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)-3-(1-methylindazol-5-yl)pyrazol-4-yl]indazol-1-yl]phosphane (PubChem CID 156792242) has the molecular formula C27H29IN7P and a molecular weight of 609.46 g/mol. Its IUPAC name is iodo-[6-methyl-4-[5-methyl-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)-3-(1-methylindazol-5-yl)pyrazol-4-yl]indazol-1-yl]phosphane.
| Compound Name | iodo-[6-methyl-4-[5-methyl-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)-3-(1-methylindazol-5-yl)pyrazol-4-yl]indazol-1-yl]phosphane |
|---|---|
| PubChem CID | 156792242 |
| Molecular Formula | C27H29IN7P |
| Molecular Weight | 609.46 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | iodo-[6-methyl-4-[5-methyl-1-(2-methyl-2-azaspiro[3.3]heptan-6-yl)-3-(1-methylindazol-5-yl)pyrazol-4-yl]indazol-1-yl]phosphane |
| SMILES | Cc1cc(-c2c(-c3ccc4c(cnn4C)c3)nn(C3CC4(C3)CN(C)C4)c2C)c2cnn(PI)c2c1 |
| InChI | InChI=1S/C27H29IN7P/c1-16-7-21(22-13-30-35(36-28)24(22)8-16)25-17(2)34(20-10-27(11-20)14-32(3)15-27)31-26(25)18-5-6-23-19(9-18)12-29-33(23)4/h5-9,12-13,20,36H,10-11,14-15H2,1-4H3 |
| InChIKey | ZVDQKFPDBXNWIT-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 56.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|