C30H35ClN6O2 — CID 156512574
1-[4-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-3-[4-[(2-methoxyethylamino)methyl]phenyl]-5-methylpyrazol-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 156512574) has the molecular formula C30H35ClN6O2 and a molecular weight of 547.10 g/mol. Its IUPAC name is 1-[4-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-3-[4-[(2-methoxyethylamino)methyl]phenyl]-5-methylpyrazol-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-3-[4-[(2-methoxyethylamino)methyl]phenyl]-5-methylpyrazol-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156512574 |
| Molecular Formula | C30H35ClN6O2 |
| Molecular Weight | 547.10 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 1-[4-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-3-[4-[(2-methoxyethylamino)methyl]phenyl]-5-methylpyrazol-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(n2nc(-c3ccc(CNCCOC)cc3)c(-c3c(Cl)c(C)cc4[nH]ncc34)c2C)CC1 |
| InChI | InChI=1S/C30H35ClN6O2/c1-5-26(38)36-13-10-23(11-14-36)37-20(3)27(28-24-18-33-34-25(24)16-19(2)29(28)31)30(35-37)22-8-6-21(7-9-22)17-32-12-15-39-4/h5-9,16,18,23,32H,1,10-15,17H2,2-4H3,(H,33,34) |
| InChIKey | ZCVFOQMAFBNDKE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.10 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|