C24H24N4O — CID 135280527
1-[4-[5-(5-methyl-1H-indazol-4-yl)indol-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 135280527) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[4-[5-(5-methyl-1H-indazol-4-yl)indol-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-(5-methyl-1H-indazol-4-yl)indol-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135280527 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[4-[5-(5-methyl-1H-indazol-4-yl)indol-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(n2ccc3cc(-c4c(C)ccc5[nH]ncc45)ccc32)CC1 |
| InChI | InChI=1S/C24H24N4O/c1-3-23(29)27-11-9-19(10-12-27)28-13-8-17-14-18(5-7-22(17)28)24-16(2)4-6-21-20(24)15-25-26-21/h3-8,13-15,19H,1,9-12H2,2H3,(H,25,26) |
| InChIKey | GIBBBLCFNLEAJU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|