C22H19FN4O — CID 135280443
1-[3-[3-fluoro-5-(5-methyl-1H-indazol-4-yl)indol-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 135280443) has the molecular formula C22H19FN4O and a molecular weight of 374.42 g/mol. Its IUPAC name is 1-[3-[3-fluoro-5-(5-methyl-1H-indazol-4-yl)indol-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[3-fluoro-5-(5-methyl-1H-indazol-4-yl)indol-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135280443 |
| Molecular Formula | C22H19FN4O |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-[3-[3-fluoro-5-(5-methyl-1H-indazol-4-yl)indol-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(n2cc(F)c3cc(-c4c(C)ccc5[nH]ncc45)ccc32)C1 |
| InChI | InChI=1S/C22H19FN4O/c1-3-21(28)26-10-15(11-26)27-12-18(23)16-8-14(5-7-20(16)27)22-13(2)4-6-19-17(22)9-24-25-19/h3-9,12,15H,1,10-11H2,2H3,(H,24,25) |
| InChIKey | DEQVUKIBUXCGIR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|