C22H21N5O3 — CID 135272538
2-(5-methyl-1H-indazol-4-yl)-6-(1-prop-2-enoylazetidin-3-yl)-3,4-dihydro-2,6-naphthyridine-1,7-dione (PubChem CID 135272538) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-(5-methyl-1H-indazol-4-yl)-6-(1-prop-2-enoylazetidin-3-yl)-3,4-dihydro-2,6-naphthyridine-1,7-dione.
| Compound Name | 2-(5-methyl-1H-indazol-4-yl)-6-(1-prop-2-enoylazetidin-3-yl)-3,4-dihydro-2,6-naphthyridine-1,7-dione |
|---|---|
| PubChem CID | 135272538 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-(5-methyl-1H-indazol-4-yl)-6-(1-prop-2-enoylazetidin-3-yl)-3,4-dihydro-2,6-naphthyridine-1,7-dione |
| SMILES | C=CC(=O)N1CC(n2cc3c(cc2=O)C(=O)N(c2c(C)ccc4[nH]ncc24)CC3)C1 |
| InChI | InChI=1S/C22H21N5O3/c1-3-19(28)25-11-15(12-25)27-10-14-6-7-26(22(30)16(14)8-20(27)29)21-13(2)4-5-18-17(21)9-23-24-18/h3-5,8-10,15H,1,6-7,11-12H2,2H3,(H,23,24) |
| InChIKey | XLMVGHCERAYHBW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|