C22H21N5O2 — CID 135271253
3-(5-methyl-1H-indazol-4-yl)-7-(1-prop-2-enoylazetidin-3-yl)-1,4-dihydroquinazolin-2-one (PubChem CID 135271253) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-(5-methyl-1H-indazol-4-yl)-7-(1-prop-2-enoylazetidin-3-yl)-1,4-dihydroquinazolin-2-one.
| Compound Name | 3-(5-methyl-1H-indazol-4-yl)-7-(1-prop-2-enoylazetidin-3-yl)-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 135271253 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-(5-methyl-1H-indazol-4-yl)-7-(1-prop-2-enoylazetidin-3-yl)-1,4-dihydroquinazolin-2-one |
| SMILES | C=CC(=O)N1CC(c2ccc3c(c2)NC(=O)N(c2c(C)ccc4[nH]ncc24)C3)C1 |
| InChI | InChI=1S/C22H21N5O2/c1-3-20(28)26-10-16(11-26)14-5-6-15-12-27(22(29)24-19(15)8-14)21-13(2)4-7-18-17(21)9-23-25-18/h3-9,16H,1,10-12H2,2H3,(H,23,25)(H,24,29) |
| InChIKey | GINIQGONBPQWQR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|