About CID 156792368
CID 156792368 (PubChem CID 156792368) has the molecular formula C11H20BN3
and a molecular weight of 205.11 g/mol.
Molecular Properties
| Compound Name | CID 156792368 |
| PubChem CID | 156792368 |
| Molecular Formula | C11H20BN3 |
| Molecular Weight | 205.11 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | — |
| SMILES | [B]/C(CC)=N/N(CC)C1CC2(CNC2)C1 |
| InChI | InChI=1S/C11H20BN3/c1-3-10(12)14-15(4-2)9-5-11(6-9)7-13-8-11/h9,13H,3-8H2,1-2H3/b14-10+ |
| InChIKey | AZOKVKWOICPMCU-GXDHUFHOSA-N |
| XLogP | 0.95 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.11 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 156792368 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156792368?
The IUPAC name of CID 156792368 (CID 156792368) is not available.
What is the SMILES notation for CID 156792368?
The canonical SMILES for CID 156792368 is [B]/C(CC)=N/N(CC)C1CC2(CNC2)C1.
What is the InChIKey of CID 156792368?
The InChIKey is AZOKVKWOICPMCU-GXDHUFHOSA-N. The full InChI is InChI=1S/C11H20BN3/c1-3-10(12)14-15(4-2)9-5-11(6-9)7-13-8-11/h9,13H,3-8H2,1-2H3/b14-10+.
What are the key properties of CID 156792368?
CID 156792368 has a molecular weight of 205.11 g/mol, XLogP of 0.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156792368 is sourced from PubChem (CID 156792368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).