C15H29F2N3S — CID 163274969
S-[2-azaspiro[3.3]heptan-6-yl-[(4,4-difluorocyclohexyl)methyl]amino]thiohydroxylamine;ethane (PubChem CID 163274969) has the molecular formula C15H29F2N3S and a molecular weight of 321.48 g/mol. Its IUPAC name is S-[2-azaspiro[3.3]heptan-6-yl-[(4,4-difluorocyclohexyl)methyl]amino]thiohydroxylamine;ethane.
| Compound Name | S-[2-azaspiro[3.3]heptan-6-yl-[(4,4-difluorocyclohexyl)methyl]amino]thiohydroxylamine;ethane |
|---|---|
| PubChem CID | 163274969 |
| Molecular Formula | C15H29F2N3S |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | S-[2-azaspiro[3.3]heptan-6-yl-[(4,4-difluorocyclohexyl)methyl]amino]thiohydroxylamine;ethane |
| SMILES | CC.NSN(CC1CCC(F)(F)CC1)C1CC2(CNC2)C1 |
| InChI | InChI=1S/C13H23F2N3S.C2H6/c14-13(15)3-1-10(2-4-13)7-18(19-16)11-5-12(6-11)8-17-9-12;1-2/h10-11,17H,1-9,16H2;1-2H3 |
| InChIKey | SFKWZKYXKPQQBB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|