C12H20F2N2O — CID 128702306
4-[(4,4-difluorocyclohexyl)methyl]-6-methylpiperazin-2-one (PubChem CID 128702306) has the molecular formula C12H20F2N2O and a molecular weight of 246.30 g/mol. Its IUPAC name is 4-[(4,4-difluorocyclohexyl)methyl]-6-methylpiperazin-2-one.
| Compound Name | 4-[(4,4-difluorocyclohexyl)methyl]-6-methylpiperazin-2-one |
|---|---|
| PubChem CID | 128702306 |
| Molecular Formula | C12H20F2N2O |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 4-[(4,4-difluorocyclohexyl)methyl]-6-methylpiperazin-2-one |
| SMILES | CC1CN(CC2CCC(F)(F)CC2)CC(=O)N1 |
| InChI | InChI=1S/C12H20F2N2O/c1-9-6-16(8-11(17)15-9)7-10-2-4-12(13,14)5-3-10/h9-10H,2-8H2,1H3,(H,15,17) |
| InChIKey | BJZISHPECNBBPG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |