C26H52N6O3 — CID 171515285
bis(6-methyl-4-(2-methylpropyl)piperazin-2-one);4-(2-methylpropyl)piperazin-2-one (PubChem CID 171515285) has the molecular formula C26H52N6O3 and a molecular weight of 496.74 g/mol. Its IUPAC name is bis(6-methyl-4-(2-methylpropyl)piperazin-2-one);4-(2-methylpropyl)piperazin-2-one.
| Compound Name | bis(6-methyl-4-(2-methylpropyl)piperazin-2-one);4-(2-methylpropyl)piperazin-2-one |
|---|---|
| PubChem CID | 171515285 |
| Molecular Formula | C26H52N6O3 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.41 |
| IUPAC Name | bis(6-methyl-4-(2-methylpropyl)piperazin-2-one);4-(2-methylpropyl)piperazin-2-one |
| SMILES | CC(C)CN1CC(=O)NC(C)C1.CC(C)CN1CC(=O)NC(C)C1.CC(C)CN1CCNC(=O)C1 |
| InChI | InChI=1S/2C9H18N2O.C8H16N2O/c2*1-7(2)4-11-5-8(3)10-9(12)6-11;1-7(2)5-10-4-3-9-8(11)6-10/h2*7-8H,4-6H2,1-3H3,(H,10,12);7H,3-6H2,1-2H3,(H,9,11) |
| InChIKey | DYDLDUWTCJRUSN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |