C7H14N2O — CID 171516065
(6R)-4-ethyl-6-methylpiperazin-2-one (PubChem CID 171516065) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is (6R)-4-ethyl-6-methylpiperazin-2-one.
| Compound Name | (6R)-4-ethyl-6-methylpiperazin-2-one |
|---|---|
| PubChem CID | 171516065 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (6R)-4-ethyl-6-methylpiperazin-2-one |
| SMILES | CCN1CC(=O)N[C@H](C)C1 |
| InChI | InChI=1S/C7H14N2O/c1-3-9-4-6(2)8-7(10)5-9/h6H,3-5H2,1-2H3,(H,8,10)/t6-/m1/s1 |
| InChIKey | XMTXEVLZHNBDHE-ZCFIWIBFSA-N |
| XLogP | -0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |