C17H29F3N2O2 — CID 156792533
ethane;3-methyl-4-propyl-1-[[3-(trifluoromethyl)piperidin-4-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 156792533) has the molecular formula C17H29F3N2O2 and a molecular weight of 350.43 g/mol. Its IUPAC name is ethane;3-methyl-4-propyl-1-[[3-(trifluoromethyl)piperidin-4-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | ethane;3-methyl-4-propyl-1-[[3-(trifluoromethyl)piperidin-4-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 156792533 |
| Molecular Formula | C17H29F3N2O2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | ethane;3-methyl-4-propyl-1-[[3-(trifluoromethyl)piperidin-4-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | CC.CCCC1C(=O)N(CC2CCNCC2C(F)(F)F)C(=O)C1C |
| InChI | InChI=1S/C15H23F3N2O2.C2H6/c1-3-4-11-9(2)13(21)20(14(11)22)8-10-5-6-19-7-12(10)15(16,17)18;1-2/h9-12,19H,3-8H2,1-2H3;1-2H3 |
| InChIKey | HSMJOZWRVCIJIW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|