C30H42BN5O3 — CID 156792771
3-[(E)-2-[1-(1-ethylpiperidin-4-yl)pyrazol-4-yl]ethenyl]-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 156792771) has the molecular formula C30H42BN5O3 and a molecular weight of 531.51 g/mol. Its IUPAC name is 3-[(E)-2-[1-(1-ethylpiperidin-4-yl)pyrazol-4-yl]ethenyl]-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 3-[(E)-2-[1-(1-ethylpiperidin-4-yl)pyrazol-4-yl]ethenyl]-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 156792771 |
| Molecular Formula | C30H42BN5O3 |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.34 |
| IUPAC Name | 3-[(E)-2-[1-(1-ethylpiperidin-4-yl)pyrazol-4-yl]ethenyl]-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CCN1CCC(n2cc(/C=C/c3nn(C4CCCCO4)c4ccc(B5OC(C)(C)C(C)(C)O5)cc34)cn2)CC1 |
| InChI | InChI=1S/C30H42BN5O3/c1-6-34-16-14-24(15-17-34)35-21-22(20-32-35)10-12-26-25-19-23(31-38-29(2,3)30(4,5)39-31)11-13-27(25)36(33-26)28-9-7-8-18-37-28/h10-13,19-21,24,28H,6-9,14-18H2,1-5H3/b12-10+ |
| InChIKey | FTIAKBXHSSWXFO-ZRDIBKRKSA-N |
| XLogP | 5.06 |
| TPSA | 66.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|