C20H26ClN3O — CID 156793601
N-[(4-chlorophenyl)methyl]-2-[3,6-dimethyl-2-(methylamino)phenyl]-2-iminoacetamide;ethane (PubChem CID 156793601) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[3,6-dimethyl-2-(methylamino)phenyl]-2-iminoacetamide;ethane.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[3,6-dimethyl-2-(methylamino)phenyl]-2-iminoacetamide;ethane |
|---|---|
| PubChem CID | 156793601 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[3,6-dimethyl-2-(methylamino)phenyl]-2-iminoacetamide;ethane |
| SMILES | CC.[H]/N=C(\C(=O)NCc1ccc(Cl)cc1)c1c(C)ccc(C)c1NC |
| InChI | InChI=1S/C18H20ClN3O.C2H6/c1-11-4-5-12(2)17(21-3)15(11)16(20)18(23)22-10-13-6-8-14(19)9-7-13;1-2/h4-9,20-21H,10H2,1-3H3,(H,22,23);1-2H3/b20-16-; |
| InChIKey | YADVPAPIHQZUMV-LRZQPWDCSA-N |
| XLogP | 4.71 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|