C33H26Cl2N4O — CID 156793634
N-[(4-chlorophenyl)methyl]-2-[6-chloro-4-(tritylamino)-3-pyridinyl]-2-iminoacetamide (PubChem CID 156793634) has the molecular formula C33H26Cl2N4O and a molecular weight of 565.50 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[6-chloro-4-(tritylamino)-3-pyridinyl]-2-iminoacetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[6-chloro-4-(tritylamino)-3-pyridinyl]-2-iminoacetamide |
|---|---|
| PubChem CID | 156793634 |
| Molecular Formula | C33H26Cl2N4O |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[6-chloro-4-(tritylamino)-3-pyridinyl]-2-iminoacetamide |
| SMILES | [H]/N=C(\C(=O)NCc1ccc(Cl)cc1)c1cnc(Cl)cc1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H26Cl2N4O/c34-27-18-16-23(17-19-27)21-38-32(40)31(36)28-22-37-30(35)20-29(28)39-33(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-20,22,36H,21H2,(H,37,39)(H,38,40)/b36-31- |
| InChIKey | FRAMPISVPCVNLL-WWIWEHRJSA-N |
| XLogP | 7.48 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|