C16H16ClN5O — CID 145260347
(Z)-4-(2-aminopyrimidin-5-yl)-N-[(4-chlorophenyl)methyl]-4-imino-2-methylbut-2-enamide (PubChem CID 145260347) has the molecular formula C16H16ClN5O and a molecular weight of 329.79 g/mol. Its IUPAC name is (Z)-4-(2-aminopyrimidin-5-yl)-N-[(4-chlorophenyl)methyl]-4-imino-2-methylbut-2-enamide.
| Compound Name | (Z)-4-(2-aminopyrimidin-5-yl)-N-[(4-chlorophenyl)methyl]-4-imino-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 145260347 |
| Molecular Formula | C16H16ClN5O |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (Z)-4-(2-aminopyrimidin-5-yl)-N-[(4-chlorophenyl)methyl]-4-imino-2-methylbut-2-enamide |
| SMILES | [H]/N=C(/C=C(/C)C(=O)NCc1ccc(Cl)cc1)c1cnc(N)nc1 |
| InChI | InChI=1S/C16H16ClN5O/c1-10(6-14(18)12-8-21-16(19)22-9-12)15(23)20-7-11-2-4-13(17)5-3-11/h2-6,8-9,18H,7H2,1H3,(H,20,23)(H2,19,21,22)/b10-6-,18-14- |
| InChIKey | HIPNCXNRUFGLLD-AFKXJYICSA-N |
| XLogP | 2.34 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|