C17H15ClFN3O — CID 145260183
(Z)-N-[(4-chlorophenyl)methyl]-4-(6-fluoro-3-pyridinyl)-4-imino-2-methylbut-2-enamide (PubChem CID 145260183) has the molecular formula C17H15ClFN3O and a molecular weight of 331.78 g/mol. Its IUPAC name is (Z)-N-[(4-chlorophenyl)methyl]-4-(6-fluoro-3-pyridinyl)-4-imino-2-methylbut-2-enamide.
| Compound Name | (Z)-N-[(4-chlorophenyl)methyl]-4-(6-fluoro-3-pyridinyl)-4-imino-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 145260183 |
| Molecular Formula | C17H15ClFN3O |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (Z)-N-[(4-chlorophenyl)methyl]-4-(6-fluoro-3-pyridinyl)-4-imino-2-methylbut-2-enamide |
| SMILES | [H]/N=C(/C=C(/C)C(=O)NCc1ccc(Cl)cc1)c1ccc(F)nc1 |
| InChI | InChI=1S/C17H15ClFN3O/c1-11(8-15(20)13-4-7-16(19)21-10-13)17(23)22-9-12-2-5-14(18)6-3-12/h2-8,10,20H,9H2,1H3,(H,22,23)/b11-8-,20-15- |
| InChIKey | NUPHEHIBLCIJMI-FNUITDIJSA-N |
| XLogP | 3.50 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|