C16H33FN2O3 — CID 156795222
N-but-1-en-2-yl-4-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethoxy]-2-fluorobutan-1-amine (PubChem CID 156795222) has the molecular formula C16H33FN2O3 and a molecular weight of 320.45 g/mol. Its IUPAC name is N-but-1-en-2-yl-4-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethoxy]-2-fluorobutan-1-amine.
| Compound Name | N-but-1-en-2-yl-4-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethoxy]-2-fluorobutan-1-amine |
|---|---|
| PubChem CID | 156795222 |
| Molecular Formula | C16H33FN2O3 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | N-but-1-en-2-yl-4-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethoxy]-2-fluorobutan-1-amine |
| SMILES | C=C(CC)NCC(F)CCOCCOCCOCCNCC |
| InChI | InChI=1S/C16H33FN2O3/c1-4-15(3)19-14-16(17)6-8-20-10-12-22-13-11-21-9-7-18-5-2/h16,18-19H,3-14H2,1-2H3 |
| InChIKey | GTDOESPKPYNIAC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|