C15H33NO2 — CID 156795257
N-[2-(2-butoxyethoxy)ethyl]-3-methylbut-1-en-2-amine;ethane (PubChem CID 156795257) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is N-[2-(2-butoxyethoxy)ethyl]-3-methylbut-1-en-2-amine;ethane.
| Compound Name | N-[2-(2-butoxyethoxy)ethyl]-3-methylbut-1-en-2-amine;ethane |
|---|---|
| PubChem CID | 156795257 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | N-[2-(2-butoxyethoxy)ethyl]-3-methylbut-1-en-2-amine;ethane |
| SMILES | C=C(NCCOCCOCCCC)C(C)C.CC |
| InChI | InChI=1S/C13H27NO2.C2H6/c1-5-6-8-15-10-11-16-9-7-14-13(4)12(2)3;1-2/h12,14H,4-11H2,1-3H3;1-2H3 |
| InChIKey | MBGLSFPYCOCFIN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|